C18H24BN5O4 — CID 176673970
[6-[[[cyclopropyl(pyrimidin-2-yl)amino]-[(2-methylpropan-2-yl)oxycarbonyl]amino]methyl]-3-pyridinyl]boronic acid (PubChem CID 176673970) has the molecular formula C18H24BN5O4 and a molecular weight of 385.23 g/mol. Its IUPAC name is [6-[[[cyclopropyl(pyrimidin-2-yl)amino]-[(2-methylpropan-2-yl)oxycarbonyl]amino]methyl]-3-pyridinyl]boronic acid.
| Compound Name | [6-[[[cyclopropyl(pyrimidin-2-yl)amino]-[(2-methylpropan-2-yl)oxycarbonyl]amino]methyl]-3-pyridinyl]boronic acid |
|---|---|
| PubChem CID | 176673970 |
| Molecular Formula | C18H24BN5O4 |
| Molecular Weight | 385.23 g/mol |
| Exact Mass | 385.19 |
| IUPAC Name | [6-[[[cyclopropyl(pyrimidin-2-yl)amino]-[(2-methylpropan-2-yl)oxycarbonyl]amino]methyl]-3-pyridinyl]boronic acid |
| SMILES | CC(C)(C)OC(=O)N(Cc1ccc(B(O)O)cn1)N(c1ncccn1)C1CC1 |
| InChI | InChI=1S/C18H24BN5O4/c1-18(2,3)28-17(25)23(12-14-6-5-13(11-22-14)19(26)27)24(15-7-8-15)16-20-9-4-10-21-16/h4-6,9-11,15,26-27H,7-8,12H2,1-3H3 |
| InChIKey | NACKQTYFQKZOKR-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 111.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.23 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|