C22H29N3O2 — CID 165153021
tert-butyl N-[(5-cyclohexyl-2-pyridinyl)methyl]-N-pyridin-3-ylcarbamate (PubChem CID 165153021) has the molecular formula C22H29N3O2 and a molecular weight of 367.49 g/mol. Its IUPAC name is tert-butyl N-[(5-cyclohexyl-2-pyridinyl)methyl]-N-pyridin-3-ylcarbamate.
| Compound Name | tert-butyl N-[(5-cyclohexyl-2-pyridinyl)methyl]-N-pyridin-3-ylcarbamate |
|---|---|
| PubChem CID | 165153021 |
| Molecular Formula | C22H29N3O2 |
| Molecular Weight | 367.49 g/mol |
| Exact Mass | 367.23 |
| IUPAC Name | tert-butyl N-[(5-cyclohexyl-2-pyridinyl)methyl]-N-pyridin-3-ylcarbamate |
| SMILES | CC(C)(C)OC(=O)N(Cc1ccc(C2CCCCC2)cn1)c1cccnc1 |
| InChI | InChI=1S/C22H29N3O2/c1-22(2,3)27-21(26)25(20-10-7-13-23-15-20)16-19-12-11-18(14-24-19)17-8-5-4-6-9-17/h7,10-15,17H,4-6,8-9,16H2,1-3H3 |
| InChIKey | MYZJQTXOWSFZGF-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 55.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.49 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |