C24H32N4O2 — CID 123771926
1-[6-[3-[6-(3-oxopentyl)pyridazin-3-yl]cyclohexyl]pyridazin-3-yl]pentan-3-one (PubChem CID 123771926) has the molecular formula C24H32N4O2 and a molecular weight of 408.55 g/mol. Its IUPAC name is 1-[6-[3-[6-(3-oxopentyl)pyridazin-3-yl]cyclohexyl]pyridazin-3-yl]pentan-3-one.
| Compound Name | 1-[6-[3-[6-(3-oxopentyl)pyridazin-3-yl]cyclohexyl]pyridazin-3-yl]pentan-3-one |
|---|---|
| PubChem CID | 123771926 |
| Molecular Formula | C24H32N4O2 |
| Molecular Weight | 408.55 g/mol |
| Exact Mass | 408.25 |
| IUPAC Name | 1-[6-[3-[6-(3-oxopentyl)pyridazin-3-yl]cyclohexyl]pyridazin-3-yl]pentan-3-one |
| SMILES | CCC(=O)CCc1ccc(C2CCCC(c3ccc(CCC(=O)CC)nn3)C2)nn1 |
| InChI | InChI=1S/C24H32N4O2/c1-3-21(29)12-8-19-10-14-23(27-25-19)17-6-5-7-18(16-17)24-15-11-20(26-28-24)9-13-22(30)4-2/h10-11,14-15,17-18H,3-9,12-13,16H2,1-2H3 |
| InChIKey | PEISHAFAESHVJT-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 85.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.55 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |