C34H34N6O6 — CID 144928571
1-(4-nitrophenyl)-4-[6-[(1S,3S)-3-[6-[4-(4-nitrophenyl)-3-oxobutyl]pyridazin-3-yl]cyclohexyl]pyridazin-3-yl]butan-2-one (PubChem CID 144928571) has the molecular formula C34H34N6O6 and a molecular weight of 622.68 g/mol. Its IUPAC name is 1-(4-nitrophenyl)-4-[6-[(1S,3S)-3-[6-[4-(4-nitrophenyl)-3-oxobutyl]pyridazin-3-yl]cyclohexyl]pyridazin-3-yl]butan-2-one.
| Compound Name | 1-(4-nitrophenyl)-4-[6-[(1S,3S)-3-[6-[4-(4-nitrophenyl)-3-oxobutyl]pyridazin-3-yl]cyclohexyl]pyridazin-3-yl]butan-2-one |
|---|---|
| PubChem CID | 144928571 |
| Molecular Formula | C34H34N6O6 |
| Molecular Weight | 622.68 g/mol |
| Exact Mass | 622.25 |
| IUPAC Name | 1-(4-nitrophenyl)-4-[6-[(1S,3S)-3-[6-[4-(4-nitrophenyl)-3-oxobutyl]pyridazin-3-yl]cyclohexyl]pyridazin-3-yl]butan-2-one |
| SMILES | O=C(CCc1ccc([C@H]2CCC[C@H](c3ccc(CCC(=O)Cc4ccc([N+](=O)[O-])cc4)nn3)C2)nn1)Cc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C34H34N6O6/c41-31(20-23-4-12-29(13-5-23)39(43)44)16-8-27-10-18-33(37-35-27)25-2-1-3-26(22-25)34-19-11-28(36-38-34)9-17-32(42)21-24-6-14-30(15-7-24)40(45)46/h4-7,10-15,18-19,25-26H,1-3,8-9,16-17,20-22H2/t25-,26-/m0/s1 |
| InChIKey | TWONONHWKRNHNH-UIOOFZCWSA-N |
| XLogP | 6.01 |
| TPSA | 171.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.68 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|