C38H57NO7 — CID 123772089
[12-amino-8-(1-ethoxy-2-hydroxy-2-methylpropyl)-11-hydroxy-4,6,17,17-tetramethyl-9-oxahexacyclo[11.9.0.01,21.04,12.05,10.016,21]docosan-18-yl] phenyl carbonate (PubChem CID 123772089) has the molecular formula C38H57NO7 and a molecular weight of 639.87 g/mol. Its IUPAC name is [12-amino-8-(1-ethoxy-2-hydroxy-2-methylpropyl)-11-hydroxy-4,6,17,17-tetramethyl-9-oxahexacyclo[11.9.0.01,21.04,12.05,10.016,21]docosan-18-yl] phenyl carbonate.
| Compound Name | [12-amino-8-(1-ethoxy-2-hydroxy-2-methylpropyl)-11-hydroxy-4,6,17,17-tetramethyl-9-oxahexacyclo[11.9.0.01,21.04,12.05,10.016,21]docosan-18-yl] phenyl carbonate |
|---|---|
| PubChem CID | 123772089 |
| Molecular Formula | C38H57NO7 |
| Molecular Weight | 639.87 g/mol |
| Exact Mass | 639.41 |
| IUPAC Name | [12-amino-8-(1-ethoxy-2-hydroxy-2-methylpropyl)-11-hydroxy-4,6,17,17-tetramethyl-9-oxahexacyclo[11.9.0.01,21.04,12.05,10.016,21]docosan-18-yl] phenyl carbonate |
| SMILES | CCOC(C1CC(C)C2C(O1)C(O)C1(N)C3CCC4C(C)(C)C(OC(=O)Oc5ccccc5)CCC45CC35CCC21C)C(C)(C)O |
| InChI | InChI=1S/C38H57NO7/c1-8-43-31(34(5,6)42)24-20-22(2)28-29(45-24)30(40)38(39)26-15-14-25-33(3,4)27(46-32(41)44-23-12-10-9-11-13-23)16-17-36(25)21-37(26,36)19-18-35(28,38)7/h9-13,22,24-31,40,42H,8,14-21,39H2,1-7H3 |
| InChIKey | AQQBMQBEBLJKGJ-UHFFFAOYSA-N |
| XLogP | 6.25 |
| TPSA | 120.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 639.87 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|