C32H54O5 — CID 71290833
(4R,5R,6R,11R,12S,16R,18S,21R)-8-[(1S)-1-ethoxy-2-hydroxy-2-methylpropyl]-4,6,12,17,17-pentamethyl-9-oxahexacyclo[11.9.0.01,21.04,12.05,10.016,21]docosane-11,18-diol (PubChem CID 71290833) has the molecular formula C32H54O5 and a molecular weight of 518.78 g/mol. Its IUPAC name is (4R,5R,6R,11R,12S,16R,18S,21R)-8-[(1S)-1-ethoxy-2-hydroxy-2-methylpropyl]-4,6,12,17,17-pentamethyl-9-oxahexacyclo[11.9.0.01,21.04,12.05,10.016,21]docosane-11,18-diol.
| Compound Name | (4R,5R,6R,11R,12S,16R,18S,21R)-8-[(1S)-1-ethoxy-2-hydroxy-2-methylpropyl]-4,6,12,17,17-pentamethyl-9-oxahexacyclo[11.9.0.01,21.04,12.05,10.016,21]docosane-11,18-diol |
|---|---|
| PubChem CID | 71290833 |
| Molecular Formula | C32H54O5 |
| Molecular Weight | 518.78 g/mol |
| Exact Mass | 518.40 |
| IUPAC Name | (4R,5R,6R,11R,12S,16R,18S,21R)-8-[(1S)-1-ethoxy-2-hydroxy-2-methylpropyl]-4,6,12,17,17-pentamethyl-9-oxahexacyclo[11.9.0.01,21.04,12.05,10.016,21]docosane-11,18-diol |
| SMILES | CCO[C@@H](C1C[C@@H](C)[C@H]2C(O1)[C@H](O)[C@@]1(C)C3CC[C@H]4C(C)(C)[C@@H](O)CC[C@@]45CC35CC[C@]21C)C(C)(C)O |
| InChI | InChI=1S/C32H54O5/c1-9-36-26(28(5,6)35)19-16-18(2)23-24(37-19)25(34)30(8)21-11-10-20-27(3,4)22(33)12-13-31(20)17-32(21,31)15-14-29(23,30)7/h18-26,33-35H,9-17H2,1-8H3/t18-,19?,20+,21?,22+,23+,24?,25+,26+,29-,30-,31-,32?/m1/s1 |
| InChIKey | DLLUIHHJDOODID-UEYZVISFSA-N |
| XLogP | 5.34 |
| TPSA | 79.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.78 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |