C34H56O5 — CID 58468666
(1S,4R,5R,6R,11R,12S,16R,21R)-8-[(1S)-2-hydroxy-2-methyl-1-(2-methylprop-2-enoxy)propyl]-4,6,12,17,17-pentamethyl-9-oxahexacyclo[11.9.0.01,21.04,12.05,10.016,21]docosane-11,18-diol (PubChem CID 58468666) has the molecular formula C34H56O5 and a molecular weight of 544.82 g/mol. Its IUPAC name is (1S,4R,5R,6R,11R,12S,16R,21R)-8-[(1S)-2-hydroxy-2-methyl-1-(2-methylprop-2-enoxy)propyl]-4,6,12,17,17-pentamethyl-9-oxahexacyclo[11.9.0.01,21.04,12.05,10.016,21]docosane-11,18-diol.
| Compound Name | (1S,4R,5R,6R,11R,12S,16R,21R)-8-[(1S)-2-hydroxy-2-methyl-1-(2-methylprop-2-enoxy)propyl]-4,6,12,17,17-pentamethyl-9-oxahexacyclo[11.9.0.01,21.04,12.05,10.016,21]docosane-11,18-diol |
|---|---|
| PubChem CID | 58468666 |
| Molecular Formula | C34H56O5 |
| Molecular Weight | 544.82 g/mol |
| Exact Mass | 544.41 |
| IUPAC Name | (1S,4R,5R,6R,11R,12S,16R,21R)-8-[(1S)-2-hydroxy-2-methyl-1-(2-methylprop-2-enoxy)propyl]-4,6,12,17,17-pentamethyl-9-oxahexacyclo[11.9.0.01,21.04,12.05,10.016,21]docosane-11,18-diol |
| SMILES | C=C(C)CO[C@@H](C1C[C@@H](C)[C@H]2C(O1)[C@H](O)[C@@]1(C)C3CC[C@H]4C(C)(C)C(O)CC[C@@]45C[C@@]35CC[C@]21C)C(C)(C)O |
| InChI | InChI=1S/C34H56O5/c1-19(2)17-38-28(30(6,7)37)21-16-20(3)25-26(39-21)27(36)32(9)23-11-10-22-29(4,5)24(35)12-13-33(22)18-34(23,33)15-14-31(25,32)8/h20-28,35-37H,1,10-18H2,2-9H3/t20-,21?,22+,23?,24?,25+,26?,27+,28+,31-,32-,33-,34+/m1/s1 |
| InChIKey | JFUVISXQBLNBAK-ZKGZYMPYSA-N |
| XLogP | 5.89 |
| TPSA | 79.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.82 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|