C34H48F3N3 — CID 123772633
(E)-N-[1,5-difluoro-6-[4-(5-fluorocyclohepta-1,4,6-trien-1-yl)piperidin-1-yl]hepta-2,4,6-trien-3-yl]-8-(2,4-dimethyl-3,4-dihydro-2H-pyrrol-5-yl)-N-methyloct-6-en-1-amine (PubChem CID 123772633) has the molecular formula C34H48F3N3 and a molecular weight of 555.77 g/mol. Its IUPAC name is (E)-N-[1,5-difluoro-6-[4-(5-fluorocyclohepta-1,4,6-trien-1-yl)piperidin-1-yl]hepta-2,4,6-trien-3-yl]-8-(2,4-dimethyl-3,4-dihydro-2H-pyrrol-5-yl)-N-methyloct-6-en-1-amine.
| Compound Name | (E)-N-[1,5-difluoro-6-[4-(5-fluorocyclohepta-1,4,6-trien-1-yl)piperidin-1-yl]hepta-2,4,6-trien-3-yl]-8-(2,4-dimethyl-3,4-dihydro-2H-pyrrol-5-yl)-N-methyloct-6-en-1-amine |
|---|---|
| PubChem CID | 123772633 |
| Molecular Formula | C34H48F3N3 |
| Molecular Weight | 555.77 g/mol |
| Exact Mass | 555.38 |
| IUPAC Name | (E)-N-[1,5-difluoro-6-[4-(5-fluorocyclohepta-1,4,6-trien-1-yl)piperidin-1-yl]hepta-2,4,6-trien-3-yl]-8-(2,4-dimethyl-3,4-dihydro-2H-pyrrol-5-yl)-N-methyloct-6-en-1-amine |
| SMILES | C=C(C(F)=CC(=CCF)N(C)CCCCC/C=C/CC1=NC(C)CC1C)N1CCC(C2=CCC=C(F)C=C2)CC1 |
| InChI | InChI=1S/C34H48F3N3/c1-26-24-27(2)38-34(26)14-9-7-5-6-8-10-21-39(4)32(17-20-35)25-33(37)28(3)40-22-18-30(19-23-40)29-12-11-13-31(36)16-15-29/h7,9,12-13,15-17,25-27,30H,3,5-6,8,10-11,14,18-24H2,1-2,4H3/b9-7+,32-17?,33-25? |
| InChIKey | FAMDPYTWWVZCLY-BCRDDRTCSA-N |
| XLogP | 8.97 |
| TPSA | 18.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.77 |
| LogP ≤ 5 | 8.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|