C12H18N2 — CID 142575190
4-(5-ethenyl-3H-pyrrol-2-yl)-1-methylpiperidine (PubChem CID 142575190) has the molecular formula C12H18N2 and a molecular weight of 190.29 g/mol. Its IUPAC name is 4-(5-ethenyl-3H-pyrrol-2-yl)-1-methylpiperidine.
| Compound Name | 4-(5-ethenyl-3H-pyrrol-2-yl)-1-methylpiperidine |
|---|---|
| PubChem CID | 142575190 |
| Molecular Formula | C12H18N2 |
| Molecular Weight | 190.29 g/mol |
| Exact Mass | 190.15 |
| IUPAC Name | 4-(5-ethenyl-3H-pyrrol-2-yl)-1-methylpiperidine |
| SMILES | C=CC1=CCC(C2CCN(C)CC2)=N1 |
| InChI | InChI=1S/C12H18N2/c1-3-11-4-5-12(13-11)10-6-8-14(2)9-7-10/h3-4,10H,1,5-9H2,2H3 |
| InChIKey | UBIHTYDEVUPIPN-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.29 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |