C10H16N2 — CID 58108227
1-methyl-4-(3H-pyrrol-2-yl)piperidine (PubChem CID 58108227) has the molecular formula C10H16N2 and a molecular weight of 164.25 g/mol. Its IUPAC name is 1-methyl-4-(3H-pyrrol-2-yl)piperidine.
| Compound Name | 1-methyl-4-(3H-pyrrol-2-yl)piperidine |
|---|---|
| PubChem CID | 58108227 |
| Molecular Formula | C10H16N2 |
| Molecular Weight | 164.25 g/mol |
| Exact Mass | 164.13 |
| IUPAC Name | 1-methyl-4-(3H-pyrrol-2-yl)piperidine |
| SMILES | CN1CCC(C2=NC=CC2)CC1 |
| InChI | InChI=1S/C10H16N2/c1-12-7-4-9(5-8-12)10-3-2-6-11-10/h2,6,9H,3-5,7-8H2,1H3 |
| InChIKey | BIUUUVZYWMQPBO-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.25 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |