C17H30N2 — CID 151401255
4-[3-(4-butylpiperidin-1-yl)propyl]-3,4-dihydropyridine (PubChem CID 151401255) has the molecular formula C17H30N2 and a molecular weight of 262.44 g/mol. Its IUPAC name is 4-[3-(4-butylpiperidin-1-yl)propyl]-3,4-dihydropyridine.
| Compound Name | 4-[3-(4-butylpiperidin-1-yl)propyl]-3,4-dihydropyridine |
|---|---|
| PubChem CID | 151401255 |
| Molecular Formula | C17H30N2 |
| Molecular Weight | 262.44 g/mol |
| Exact Mass | 262.24 |
| IUPAC Name | 4-[3-(4-butylpiperidin-1-yl)propyl]-3,4-dihydropyridine |
| SMILES | CCCCC1CCN(CCCC2C=CN=CC2)CC1 |
| InChI | InChI=1S/C17H30N2/c1-2-3-5-17-9-14-19(15-10-17)13-4-6-16-7-11-18-12-8-16/h7,11-12,16-17H,2-6,8-10,13-15H2,1H3 |
| InChIKey | OWNMFKJBSBENAN-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.44 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |