C14H26N2 — CID 139538966
2-propan-2-yl-N,N-dipropyl-3,4-dihydropyridin-3-amine (PubChem CID 139538966) has the molecular formula C14H26N2 and a molecular weight of 222.38 g/mol. Its IUPAC name is 2-propan-2-yl-N,N-dipropyl-3,4-dihydropyridin-3-amine.
| Compound Name | 2-propan-2-yl-N,N-dipropyl-3,4-dihydropyridin-3-amine |
|---|---|
| PubChem CID | 139538966 |
| Molecular Formula | C14H26N2 |
| Molecular Weight | 222.38 g/mol |
| Exact Mass | 222.21 |
| IUPAC Name | 2-propan-2-yl-N,N-dipropyl-3,4-dihydropyridin-3-amine |
| SMILES | CCCN(CCC)C1CC=CN=C1C(C)C |
| InChI | InChI=1S/C14H26N2/c1-5-10-16(11-6-2)13-8-7-9-15-14(13)12(3)4/h7,9,12-13H,5-6,8,10-11H2,1-4H3 |
| InChIKey | MYVGELCPMOMYRF-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.38 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |