C10H18N2 — CID 57244631
1-ethyl-N-propan-2-yl-2,4-dihydropyridin-3-imine (PubChem CID 57244631) has the molecular formula C10H18N2 and a molecular weight of 166.27 g/mol. Its IUPAC name is 1-ethyl-N-propan-2-yl-2,4-dihydropyridin-3-imine.
| Compound Name | 1-ethyl-N-propan-2-yl-2,4-dihydropyridin-3-imine |
|---|---|
| PubChem CID | 57244631 |
| Molecular Formula | C10H18N2 |
| Molecular Weight | 166.27 g/mol |
| Exact Mass | 166.15 |
| IUPAC Name | 1-ethyl-N-propan-2-yl-2,4-dihydropyridin-3-imine |
| SMILES | CCN1C=CC/C(=N\C(C)C)C1 |
| InChI | InChI=1S/C10H18N2/c1-4-12-7-5-6-10(8-12)11-9(2)3/h5,7,9H,4,6,8H2,1-3H3/b11-10+ |
| InChIKey | GAIFRLDUQTXICO-ZHACJKMWSA-N |
| XLogP | 2.08 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.27 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|