C11H20N2 — CID 57168100
1-ethyl-5-methyl-N-propan-2-yl-2,4-dihydropyridin-3-imine (PubChem CID 57168100) has the molecular formula C11H20N2 and a molecular weight of 180.29 g/mol. Its IUPAC name is 1-ethyl-5-methyl-N-propan-2-yl-2,4-dihydropyridin-3-imine.
| Compound Name | 1-ethyl-5-methyl-N-propan-2-yl-2,4-dihydropyridin-3-imine |
|---|---|
| PubChem CID | 57168100 |
| Molecular Formula | C11H20N2 |
| Molecular Weight | 180.29 g/mol |
| Exact Mass | 180.16 |
| IUPAC Name | 1-ethyl-5-methyl-N-propan-2-yl-2,4-dihydropyridin-3-imine |
| SMILES | CCN1C=C(C)C/C(=N\C(C)C)C1 |
| InChI | InChI=1S/C11H20N2/c1-5-13-7-10(4)6-11(8-13)12-9(2)3/h7,9H,5-6,8H2,1-4H3/b12-11+ |
| InChIKey | IXMHEUQYKYHTKK-VAWYXSNFSA-N |
| XLogP | 2.47 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.29 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|