About 5-methyl-1-(2-methylpropyl)-2,4-dihydropyridin-3-imine
5-methyl-1-(2-methylpropyl)-2,4-dihydropyridin-3-imine (PubChem CID 56616930) has the molecular formula C10H18N2
and a molecular weight of 166.27 g/mol. Its IUPAC name is 5-methyl-1-(2-methylpropyl)-2,4-dihydropyridin-3-imine.
Molecular Properties
| Compound Name | 5-methyl-1-(2-methylpropyl)-2,4-dihydropyridin-3-imine |
| PubChem CID | 56616930 |
| Molecular Formula | C10H18N2 |
| Molecular Weight | 166.27 g/mol |
| Exact Mass | 166.15 |
| IUPAC Name | 5-methyl-1-(2-methylpropyl)-2,4-dihydropyridin-3-imine |
| SMILES | [H]/N=C1\CC(C)=CN(CC(C)C)C1 |
| InChI | InChI=1S/C10H18N2/c1-8(2)5-12-6-9(3)4-10(11)7-12/h6,8,11H,4-5,7H2,1-3H3/b11-10+ |
| InChIKey | WIPZTAOXRFYNMG-ZHACJKMWSA-N |
| XLogP | 2.27 |
| TPSA | 27.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.27 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 5-methyl-1-(2-methylpropyl)-2,4-dihydropyridin-3-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methyl-1-(2-methylpropyl)-2,4-dihydropyridin-3-imine?
The IUPAC name of 5-methyl-1-(2-methylpropyl)-2,4-dihydropyridin-3-imine (CID 56616930) is 5-methyl-1-(2-methylpropyl)-2,4-dihydropyridin-3-imine.
What is the SMILES notation for 5-methyl-1-(2-methylpropyl)-2,4-dihydropyridin-3-imine?
The canonical SMILES for 5-methyl-1-(2-methylpropyl)-2,4-dihydropyridin-3-imine is [H]/N=C1\CC(C)=CN(CC(C)C)C1.
What is the InChIKey of 5-methyl-1-(2-methylpropyl)-2,4-dihydropyridin-3-imine?
The InChIKey is WIPZTAOXRFYNMG-ZHACJKMWSA-N. The full InChI is InChI=1S/C10H18N2/c1-8(2)5-12-6-9(3)4-10(11)7-12/h6,8,11H,4-5,7H2,1-3H3/b11-10+.
What are the key properties of 5-methyl-1-(2-methylpropyl)-2,4-dihydropyridin-3-imine?
5-methyl-1-(2-methylpropyl)-2,4-dihydropyridin-3-imine has a molecular weight of 166.27 g/mol, XLogP of 2.27, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methyl-1-(2-methylpropyl)-2,4-dihydropyridin-3-imine is sourced from PubChem (CID 56616930), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).