C7H13N3 — CID 56612588
(1,5-dimethyl-2,4-dihydropyridin-3-ylidene)hydrazine (PubChem CID 56612588) has the molecular formula C7H13N3 and a molecular weight of 139.20 g/mol. Its IUPAC name is (1,5-dimethyl-2,4-dihydropyridin-3-ylidene)hydrazine.
| Compound Name | (1,5-dimethyl-2,4-dihydropyridin-3-ylidene)hydrazine |
|---|---|
| PubChem CID | 56612588 |
| Molecular Formula | C7H13N3 |
| Molecular Weight | 139.20 g/mol |
| Exact Mass | 139.11 |
| IUPAC Name | (1,5-dimethyl-2,4-dihydropyridin-3-ylidene)hydrazine |
| SMILES | CC1=CN(C)CC(=NN)C1 |
| InChI | InChI=1S/C7H13N3/c1-6-3-7(9-8)5-10(2)4-6/h4H,3,5,8H2,1-2H3 |
| InChIKey | LCGFQXXWSLIQMN-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 41.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 139.20 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|