C7H12N2 — CID 56618651
1,5-dimethyl-2,4-dihydropyridin-3-imine (PubChem CID 56618651) has the molecular formula C7H12N2 and a molecular weight of 124.19 g/mol. Its IUPAC name is 1,5-dimethyl-2,4-dihydropyridin-3-imine.
| Compound Name | 1,5-dimethyl-2,4-dihydropyridin-3-imine |
|---|---|
| PubChem CID | 56618651 |
| Molecular Formula | C7H12N2 |
| Molecular Weight | 124.19 g/mol |
| Exact Mass | 124.10 |
| IUPAC Name | 1,5-dimethyl-2,4-dihydropyridin-3-imine |
| SMILES | [H]/N=C1\CC(C)=CN(C)C1 |
| InChI | InChI=1S/C7H12N2/c1-6-3-7(8)5-9(2)4-6/h4,8H,3,5H2,1-2H3/b8-7+ |
| InChIKey | DDEYWPPPZIFRFK-BQYQJAHWSA-N |
| XLogP | 1.25 |
| TPSA | 27.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 124.19 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|