C9H15FN2 — CID 57322744
1,5-diethyl-2-fluoro-2,4-dihydropyridin-3-imine (PubChem CID 57322744) has the molecular formula C9H15FN2 and a molecular weight of 170.23 g/mol. Its IUPAC name is 1,5-diethyl-2-fluoro-2,4-dihydropyridin-3-imine.
| Compound Name | 1,5-diethyl-2-fluoro-2,4-dihydropyridin-3-imine |
|---|---|
| PubChem CID | 57322744 |
| Molecular Formula | C9H15FN2 |
| Molecular Weight | 170.23 g/mol |
| Exact Mass | 170.12 |
| IUPAC Name | 1,5-diethyl-2-fluoro-2,4-dihydropyridin-3-imine |
| SMILES | [H]/N=C1\CC(CC)=CN(CC)C1F |
| InChI | InChI=1S/C9H15FN2/c1-3-7-5-8(11)9(10)12(4-2)6-7/h6,9,11H,3-5H2,1-2H3/b11-8+ |
| InChIKey | DTZGFLIWLPEQPB-DHZHZOJOSA-N |
| XLogP | 2.32 |
| TPSA | 27.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.23 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|