C10H16N2 — CID 56627199
1,5-dimethyl-N-prop-2-enyl-2,4-dihydropyridin-3-imine (PubChem CID 56627199) has the molecular formula C10H16N2 and a molecular weight of 164.25 g/mol. Its IUPAC name is 1,5-dimethyl-N-prop-2-enyl-2,4-dihydropyridin-3-imine.
| Compound Name | 1,5-dimethyl-N-prop-2-enyl-2,4-dihydropyridin-3-imine |
|---|---|
| PubChem CID | 56627199 |
| Molecular Formula | C10H16N2 |
| Molecular Weight | 164.25 g/mol |
| Exact Mass | 164.13 |
| IUPAC Name | 1,5-dimethyl-N-prop-2-enyl-2,4-dihydropyridin-3-imine |
| SMILES | C=CC/N=C1\CC(C)=CN(C)C1 |
| InChI | InChI=1S/C10H16N2/c1-4-5-11-10-6-9(2)7-12(3)8-10/h4,7H,1,5-6,8H2,2-3H3/b11-10+ |
| InChIKey | PACAGUOGKAGMOT-ZHACJKMWSA-N |
| XLogP | 1.85 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.25 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|