C13H24N2 — CID 57014228
1,5-diethyl-2-methyl-N-propan-2-yl-2,4-dihydropyridin-3-imine (PubChem CID 57014228) has the molecular formula C13H24N2 and a molecular weight of 208.35 g/mol. Its IUPAC name is 1,5-diethyl-2-methyl-N-propan-2-yl-2,4-dihydropyridin-3-imine.
| Compound Name | 1,5-diethyl-2-methyl-N-propan-2-yl-2,4-dihydropyridin-3-imine |
|---|---|
| PubChem CID | 57014228 |
| Molecular Formula | C13H24N2 |
| Molecular Weight | 208.35 g/mol |
| Exact Mass | 208.19 |
| IUPAC Name | 1,5-diethyl-2-methyl-N-propan-2-yl-2,4-dihydropyridin-3-imine |
| SMILES | CCC1=CN(CC)C(C)/C(=N/C(C)C)C1 |
| InChI | InChI=1S/C13H24N2/c1-6-12-8-13(14-10(3)4)11(5)15(7-2)9-12/h9-11H,6-8H2,1-5H3/b14-13+ |
| InChIKey | ORIAIBOXVQHLMF-BUHFOSPRSA-N |
| XLogP | 3.24 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.35 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|