C14H26N2 — CID 123494328
N-methyl-N-(2-methyliminobutyl)octa-1,7-dien-2-amine (PubChem CID 123494328) has the molecular formula C14H26N2 and a molecular weight of 222.38 g/mol. Its IUPAC name is N-methyl-N-(2-methyliminobutyl)octa-1,7-dien-2-amine.
| Compound Name | N-methyl-N-(2-methyliminobutyl)octa-1,7-dien-2-amine |
|---|---|
| PubChem CID | 123494328 |
| Molecular Formula | C14H26N2 |
| Molecular Weight | 222.38 g/mol |
| Exact Mass | 222.21 |
| IUPAC Name | N-methyl-N-(2-methyliminobutyl)octa-1,7-dien-2-amine |
| SMILES | C=CCCCCC(=C)N(C)C/C(CC)=N/C |
| InChI | InChI=1S/C14H26N2/c1-6-8-9-10-11-13(3)16(5)12-14(7-2)15-4/h6H,1,3,7-12H2,2,4-5H3/b15-14+ |
| InChIKey | HQEAKMAMVPDLBK-CCEZHUSRSA-N |
| XLogP | 3.66 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.38 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|