About 5-[[(5S)-5-(4-phenoxyphenyl)-2,5-dihydro-1,2-oxazol-3-yl]oxy]pyridine-3-carboxamide
5-[[(5S)-5-(4-phenoxyphenyl)-2,5-dihydro-1,2-oxazol-3-yl]oxy]pyridine-3-carboxamide (PubChem CID 123773067) has the molecular formula C21H17N3O4
and a molecular weight of 375.38 g/mol. Its IUPAC name is 5-[[(5S)-5-(4-phenoxyphenyl)-2,5-dihydro-1,2-oxazol-3-yl]oxy]pyridine-3-carboxamide.
Molecular Properties
| Compound Name | 5-[[(5S)-5-(4-phenoxyphenyl)-2,5-dihydro-1,2-oxazol-3-yl]oxy]pyridine-3-carboxamide |
| PubChem CID | 123773067 |
| Molecular Formula | C21H17N3O4 |
| Molecular Weight | 375.38 g/mol |
| Exact Mass | 375.12 |
| IUPAC Name | 5-[[(5S)-5-(4-phenoxyphenyl)-2,5-dihydro-1,2-oxazol-3-yl]oxy]pyridine-3-carboxamide |
| SMILES | NC(=O)c1cncc(OC2=C[C@@H](c3ccc(Oc4ccccc4)cc3)ON2)c1 |
| InChI | InChI=1S/C21H17N3O4/c22-21(25)15-10-18(13-23-12-15)27-20-11-19(28-24-20)14-6-8-17(9-7-14)26-16-4-2-1-3-5-16/h1-13,19,24H,(H2,22,25)/t19-/m0/s1 |
| InChIKey | SXWKTDJNIBMLJM-IBGZPJMESA-N |
| XLogP | 3.47 |
| TPSA | 95.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 375.38 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 5-[[(5S)-5-(4-phenoxyphenyl)-2,5-dihydro-1,2-oxazol-3-yl]oxy]pyridine-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[[(5S)-5-(4-phenoxyphenyl)-2,5-dihydro-1,2-oxazol-3-yl]oxy]pyridine-3-carboxamide?
The IUPAC name of 5-[[(5S)-5-(4-phenoxyphenyl)-2,5-dihydro-1,2-oxazol-3-yl]oxy]pyridine-3-carboxamide (CID 123773067) is 5-[[(5S)-5-(4-phenoxyphenyl)-2,5-dihydro-1,2-oxazol-3-yl]oxy]pyridine-3-carboxamide.
What is the SMILES notation for 5-[[(5S)-5-(4-phenoxyphenyl)-2,5-dihydro-1,2-oxazol-3-yl]oxy]pyridine-3-carboxamide?
The canonical SMILES for 5-[[(5S)-5-(4-phenoxyphenyl)-2,5-dihydro-1,2-oxazol-3-yl]oxy]pyridine-3-carboxamide is NC(=O)c1cncc(OC2=C[C@@H](c3ccc(Oc4ccccc4)cc3)ON2)c1.
What is the InChIKey of 5-[[(5S)-5-(4-phenoxyphenyl)-2,5-dihydro-1,2-oxazol-3-yl]oxy]pyridine-3-carboxamide?
The InChIKey is SXWKTDJNIBMLJM-IBGZPJMESA-N. The full InChI is InChI=1S/C21H17N3O4/c22-21(25)15-10-18(13-23-12-15)27-20-11-19(28-24-20)14-6-8-17(9-7-14)26-16-4-2-1-3-5-16/h1-13,19,24H,(H2,22,25)/t19-/m0/s1.
What are the key properties of 5-[[(5S)-5-(4-phenoxyphenyl)-2,5-dihydro-1,2-oxazol-3-yl]oxy]pyridine-3-carboxamide?
5-[[(5S)-5-(4-phenoxyphenyl)-2,5-dihydro-1,2-oxazol-3-yl]oxy]pyridine-3-carboxamide has a molecular weight of 375.38 g/mol, XLogP of 3.47, 6 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[[(5S)-5-(4-phenoxyphenyl)-2,5-dihydro-1,2-oxazol-3-yl]oxy]pyridine-3-carboxamide is sourced from PubChem (CID 123773067), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).