C12H12N4O — CID 123774955
4-amino-6-(2-methylanilino)pyrimidine-5-carbaldehyde (PubChem CID 123774955) has the molecular formula C12H12N4O and a molecular weight of 228.25 g/mol. Its IUPAC name is 4-amino-6-(2-methylanilino)pyrimidine-5-carbaldehyde.
| Compound Name | 4-amino-6-(2-methylanilino)pyrimidine-5-carbaldehyde |
|---|---|
| PubChem CID | 123774955 |
| Molecular Formula | C12H12N4O |
| Molecular Weight | 228.25 g/mol |
| Exact Mass | 228.10 |
| IUPAC Name | 4-amino-6-(2-methylanilino)pyrimidine-5-carbaldehyde |
| SMILES | Cc1ccccc1Nc1ncnc(N)c1C=O |
| InChI | InChI=1S/C12H12N4O/c1-8-4-2-3-5-10(8)16-12-9(6-17)11(13)14-7-15-12/h2-7H,1H3,(H3,13,14,15,16) |
| InChIKey | BCCOCFXCIPBQAM-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.25 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|