C20H18F2N2O3 — CID 123775542
1,3-bis[(2R)-2-fluoro-2-phenylethyl]-6-hydroxypyrimidine-2,4-dione (PubChem CID 123775542) has the molecular formula C20H18F2N2O3 and a molecular weight of 372.37 g/mol. Its IUPAC name is 1,3-bis[(2R)-2-fluoro-2-phenylethyl]-6-hydroxypyrimidine-2,4-dione.
| Compound Name | 1,3-bis[(2R)-2-fluoro-2-phenylethyl]-6-hydroxypyrimidine-2,4-dione |
|---|---|
| PubChem CID | 123775542 |
| Molecular Formula | C20H18F2N2O3 |
| Molecular Weight | 372.37 g/mol |
| Exact Mass | 372.13 |
| IUPAC Name | 1,3-bis[(2R)-2-fluoro-2-phenylethyl]-6-hydroxypyrimidine-2,4-dione |
| SMILES | O=c1cc(O)n(C[C@H](F)c2ccccc2)c(=O)n1C[C@H](F)c1ccccc1 |
| InChI | InChI=1S/C20H18F2N2O3/c21-16(14-7-3-1-4-8-14)12-23-18(25)11-19(26)24(20(23)27)13-17(22)15-9-5-2-6-10-15/h1-11,16-17,25H,12-13H2/t16-,17-/m0/s1 |
| InChIKey | AIVDFMJPKSLAQK-IRXDYDNUSA-N |
| XLogP | 3.14 |
| TPSA | 64.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.37 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |