C20H38O5 — CID 123776236
dodecyl 3-[2-(2-hydroxyethoxy)ethoxy]-2-methylprop-2-enoate (PubChem CID 123776236) has the molecular formula C20H38O5 and a molecular weight of 358.52 g/mol. Its IUPAC name is dodecyl 3-[2-(2-hydroxyethoxy)ethoxy]-2-methylprop-2-enoate.
| Compound Name | dodecyl 3-[2-(2-hydroxyethoxy)ethoxy]-2-methylprop-2-enoate |
|---|---|
| PubChem CID | 123776236 |
| Molecular Formula | C20H38O5 |
| Molecular Weight | 358.52 g/mol |
| Exact Mass | 358.27 |
| IUPAC Name | dodecyl 3-[2-(2-hydroxyethoxy)ethoxy]-2-methylprop-2-enoate |
| SMILES | CCCCCCCCCCCCOC(=O)C(C)=COCCOCCO |
| InChI | InChI=1S/C20H38O5/c1-3-4-5-6-7-8-9-10-11-12-14-25-20(22)19(2)18-24-17-16-23-15-13-21/h18,21H,3-17H2,1-2H3 |
| InChIKey | IJDYEDBLAROYCC-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.52 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|