C23H42O8 — CID 87673238
hexyl 2-methylidenebutanoate;2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethyl 2-methylprop-2-enoate (PubChem CID 87673238) has the molecular formula C23H42O8 and a molecular weight of 446.58 g/mol. Its IUPAC name is hexyl 2-methylidenebutanoate;2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethyl 2-methylprop-2-enoate.
| Compound Name | hexyl 2-methylidenebutanoate;2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 87673238 |
| Molecular Formula | C23H42O8 |
| Molecular Weight | 446.58 g/mol |
| Exact Mass | 446.29 |
| IUPAC Name | hexyl 2-methylidenebutanoate;2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCOCCOCCOCCO.C=C(CC)C(=O)OCCCCCC |
| InChI | InChI=1S/C12H22O6.C11H20O2/c1-11(2)12(14)18-10-9-17-8-7-16-6-5-15-4-3-13;1-4-6-7-8-9-13-11(12)10(3)5-2/h13H,1,3-10H2,2H3;3-9H2,1-2H3 |
| InChIKey | WOUIRECPBPATGA-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 100.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.58 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|