C18H18ClN3O — CID 123776383
N-[3-chloro-4-(1,3-diiminopropan-2-yl)phenyl]-3-phenylpropanamide (PubChem CID 123776383) has the molecular formula C18H18ClN3O and a molecular weight of 327.81 g/mol. Its IUPAC name is N-[3-chloro-4-(1,3-diiminopropan-2-yl)phenyl]-3-phenylpropanamide.
| Compound Name | N-[3-chloro-4-(1,3-diiminopropan-2-yl)phenyl]-3-phenylpropanamide |
|---|---|
| PubChem CID | 123776383 |
| Molecular Formula | C18H18ClN3O |
| Molecular Weight | 327.81 g/mol |
| Exact Mass | 327.11 |
| IUPAC Name | N-[3-chloro-4-(1,3-diiminopropan-2-yl)phenyl]-3-phenylpropanamide |
| SMILES | [H]/N=C/C(/C=N/[H])c1ccc(NC(=O)CCc2ccccc2)cc1Cl |
| InChI | InChI=1S/C18H18ClN3O/c19-17-10-15(7-8-16(17)14(11-20)12-21)22-18(23)9-6-13-4-2-1-3-5-13/h1-5,7-8,10-12,14,20-21H,6,9H2,(H,22,23)/b20-11+,21-12+ |
| InChIKey | IPJHYALNLXPAFJ-HGEIODPWSA-N |
| XLogP | 4.29 |
| TPSA | 76.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.81 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|