About O-(dimethylamino) butanethioate
O-(dimethylamino) butanethioate (PubChem CID 123777300) has the molecular formula C6H13NOS
and a molecular weight of 147.24 g/mol. Its IUPAC name is O-(dimethylamino) butanethioate.
Molecular Properties
| Compound Name | O-(dimethylamino) butanethioate |
| PubChem CID | 123777300 |
| Molecular Formula | C6H13NOS |
| Molecular Weight | 147.24 g/mol |
| Exact Mass | 147.07 |
| IUPAC Name | O-(dimethylamino) butanethioate |
| SMILES | CCCC(=S)ON(C)C |
| InChI | InChI=1S/C6H13NOS/c1-4-5-6(9)8-7(2)3/h4-5H2,1-3H3 |
| InChIKey | NUTFECBMSPENQL-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 147.24 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze O-(dimethylamino) butanethioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of O-(dimethylamino) butanethioate?
The IUPAC name of O-(dimethylamino) butanethioate (CID 123777300) is O-(dimethylamino) butanethioate.
What is the SMILES notation for O-(dimethylamino) butanethioate?
The canonical SMILES for O-(dimethylamino) butanethioate is CCCC(=S)ON(C)C.
What is the InChIKey of O-(dimethylamino) butanethioate?
The InChIKey is NUTFECBMSPENQL-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H13NOS/c1-4-5-6(9)8-7(2)3/h4-5H2,1-3H3.
What are the key properties of O-(dimethylamino) butanethioate?
O-(dimethylamino) butanethioate has a molecular weight of 147.24 g/mol, XLogP of 1.61, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for O-(dimethylamino) butanethioate is sourced from PubChem (CID 123777300), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).