C22H42N2OS — CID 123778317
3-(4-aminobutyl)-N-(4-cyclohexyl-2-sulfanylbutyl)cycloheptane-1-carboxamide (PubChem CID 123778317) has the molecular formula C22H42N2OS and a molecular weight of 382.66 g/mol. Its IUPAC name is 3-(4-aminobutyl)-N-(4-cyclohexyl-2-sulfanylbutyl)cycloheptane-1-carboxamide.
| Compound Name | 3-(4-aminobutyl)-N-(4-cyclohexyl-2-sulfanylbutyl)cycloheptane-1-carboxamide |
|---|---|
| PubChem CID | 123778317 |
| Molecular Formula | C22H42N2OS |
| Molecular Weight | 382.66 g/mol |
| Exact Mass | 382.30 |
| IUPAC Name | 3-(4-aminobutyl)-N-(4-cyclohexyl-2-sulfanylbutyl)cycloheptane-1-carboxamide |
| SMILES | NCCCCC1CCCCC(C(=O)NCC(S)CCC2CCCCC2)C1 |
| InChI | InChI=1S/C22H42N2OS/c23-15-7-6-11-19-10-4-5-12-20(16-19)22(25)24-17-21(26)14-13-18-8-2-1-3-9-18/h18-21,26H,1-17,23H2,(H,24,25) |
| InChIKey | WXRSNASORGKDBI-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.66 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|