C25H48N4Si+2 — CID 123778578
1,5,7-tri(butan-2-yl)-2,4,8,10-tetramethyl-11-propyl-1,7-diaza-5,11-diazonia-6-silaspiro[5.5]undeca-2,4,8,10-tetraene (PubChem CID 123778578) has the molecular formula C25H48N4Si+2 and a molecular weight of 432.77 g/mol. Its IUPAC name is 1,5,7-tri(butan-2-yl)-2,4,8,10-tetramethyl-11-propyl-1,7-diaza-5,11-diazonia-6-silaspiro[5.5]undeca-2,4,8,10-tetraene.
| Compound Name | 1,5,7-tri(butan-2-yl)-2,4,8,10-tetramethyl-11-propyl-1,7-diaza-5,11-diazonia-6-silaspiro[5.5]undeca-2,4,8,10-tetraene |
|---|---|
| PubChem CID | 123778578 |
| Molecular Formula | C25H48N4Si+2 |
| Molecular Weight | 432.77 g/mol |
| Exact Mass | 432.36 |
| IUPAC Name | 1,5,7-tri(butan-2-yl)-2,4,8,10-tetramethyl-11-propyl-1,7-diaza-5,11-diazonia-6-silaspiro[5.5]undeca-2,4,8,10-tetraene |
| SMILES | CCC[N+]1=C(C)C=C(C)N(C(C)CC)[Si]12N(C(C)CC)C(C)=CC(C)=[N+]2C(C)CC |
| InChI | InChI=1S/C25H48N4Si/c1-12-16-26-22(8)17-23(9)27(19(5)13-2)30(26)28(20(6)14-3)24(10)18-25(11)29(30)21(7)15-4/h17-21H,12-16H2,1-11H3/q+2 |
| InChIKey | BPLNHFRRWJZNMV-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 12.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.77 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|