About manganese(2+);bis(propan-2-yl-[(Z)-4-propan-2-yliminopent-2-en-2-yl]azanide)
manganese(2+);bis(propan-2-yl-[(Z)-4-propan-2-yliminopent-2-en-2-yl]azanide) (PubChem CID 162407548) has the molecular formula C22H42MnN4
and a molecular weight of 417.54 g/mol. Its IUPAC name is manganese(2+);bis(propan-2-yl-[(Z)-4-propan-2-yliminopent-2-en-2-yl]azanide).
Molecular Properties
| Compound Name | manganese(2+);bis(propan-2-yl-[(Z)-4-propan-2-yliminopent-2-en-2-yl]azanide) |
| PubChem CID | 162407548 |
| Molecular Formula | C22H42MnN4 |
| Molecular Weight | 417.54 g/mol |
| Exact Mass | 417.28 |
| IUPAC Name | manganese(2+);bis(propan-2-yl-[(Z)-4-propan-2-yliminopent-2-en-2-yl]azanide) |
| SMILES | C/C(=C/C(C)=N/C(C)C)[N-]C(C)C.C/C(=C/C(C)=N\C(C)C)[N-]C(C)C.[Mn+2] |
| InChI | InChI=1S/2C11H21N2.Mn/c2*1-8(2)12-10(5)7-11(6)13-9(3)4;/h2*7-9H,1-6H3;/q2*-1;+2/b10-7-,13-11+;10-7-,13-11-; |
| InChIKey | UTNBKODYSPVJTI-GDZZJYADSA-N |
| XLogP | 7.08 |
| TPSA | 52.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 417.54 |
| LogP ≤ 5 | 7.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze manganese(2+);bis(propan-2-yl-[(Z)-4-propan-2-yliminopent-2-en-2-yl]azanide) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of manganese(2+);bis(propan-2-yl-[(Z)-4-propan-2-yliminopent-2-en-2-yl]azanide)?
The IUPAC name of manganese(2+);bis(propan-2-yl-[(Z)-4-propan-2-yliminopent-2-en-2-yl]azanide) (CID 162407548) is manganese(2+);bis(propan-2-yl-[(Z)-4-propan-2-yliminopent-2-en-2-yl]azanide).
What is the SMILES notation for manganese(2+);bis(propan-2-yl-[(Z)-4-propan-2-yliminopent-2-en-2-yl]azanide)?
The canonical SMILES for manganese(2+);bis(propan-2-yl-[(Z)-4-propan-2-yliminopent-2-en-2-yl]azanide) is C/C(=C/C(C)=N/C(C)C)[N-]C(C)C.C/C(=C/C(C)=N\C(C)C)[N-]C(C)C.[Mn+2].
What is the InChIKey of manganese(2+);bis(propan-2-yl-[(Z)-4-propan-2-yliminopent-2-en-2-yl]azanide)?
The InChIKey is UTNBKODYSPVJTI-GDZZJYADSA-N. The full InChI is InChI=1S/2C11H21N2.Mn/c2*1-8(2)12-10(5)7-11(6)13-9(3)4;/h2*7-9H,1-6H3;/q2*-1;+2/b10-7-,13-11+;10-7-,13-11-;.
What are the key properties of manganese(2+);bis(propan-2-yl-[(Z)-4-propan-2-yliminopent-2-en-2-yl]azanide)?
manganese(2+);bis(propan-2-yl-[(Z)-4-propan-2-yliminopent-2-en-2-yl]azanide) has a molecular weight of 417.54 g/mol, XLogP of 7.08, 8 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for manganese(2+);bis(propan-2-yl-[(Z)-4-propan-2-yliminopent-2-en-2-yl]azanide) is sourced from PubChem (CID 162407548), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).