About bis(tert-butyl-[(Z)-4-tert-butyliminopent-2-en-2-yl]azanide);manganese(2+)
bis(tert-butyl-[(Z)-4-tert-butyliminopent-2-en-2-yl]azanide);manganese(2+) (PubChem CID 162410087) has the molecular formula C26H50MnN4
and a molecular weight of 473.65 g/mol. Its IUPAC name is bis(tert-butyl-[(Z)-4-tert-butyliminopent-2-en-2-yl]azanide);manganese(2+).
Molecular Properties
| Compound Name | bis(tert-butyl-[(Z)-4-tert-butyliminopent-2-en-2-yl]azanide);manganese(2+) |
| PubChem CID | 162410087 |
| Molecular Formula | C26H50MnN4 |
| Molecular Weight | 473.65 g/mol |
| Exact Mass | 473.34 |
| IUPAC Name | bis(tert-butyl-[(Z)-4-tert-butyliminopent-2-en-2-yl]azanide);manganese(2+) |
| SMILES | C/C(=C/C(C)=N\C(C)(C)C)[N-]C(C)(C)C.C/C(=C/C(C)=N\C(C)(C)C)[N-]C(C)(C)C.[Mn+2] |
| InChI | InChI=1S/2C13H25N2.Mn/c2*1-10(14-12(3,4)5)9-11(2)15-13(6,7)8;/h2*9H,1-8H3;/q2*-1;+2/b2*10-9-,15-11-; |
| InChIKey | IYVWZTFDMLJIFQ-QCCMVMLGSA-N |
| XLogP | 8.64 |
| TPSA | 52.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 473.65 |
| LogP ≤ 5 | 8.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze bis(tert-butyl-[(Z)-4-tert-butyliminopent-2-en-2-yl]azanide);manganese(2+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(tert-butyl-[(Z)-4-tert-butyliminopent-2-en-2-yl]azanide);manganese(2+)?
The IUPAC name of bis(tert-butyl-[(Z)-4-tert-butyliminopent-2-en-2-yl]azanide);manganese(2+) (CID 162410087) is bis(tert-butyl-[(Z)-4-tert-butyliminopent-2-en-2-yl]azanide);manganese(2+).
What is the SMILES notation for bis(tert-butyl-[(Z)-4-tert-butyliminopent-2-en-2-yl]azanide);manganese(2+)?
The canonical SMILES for bis(tert-butyl-[(Z)-4-tert-butyliminopent-2-en-2-yl]azanide);manganese(2+) is C/C(=C/C(C)=N\C(C)(C)C)[N-]C(C)(C)C.C/C(=C/C(C)=N\C(C)(C)C)[N-]C(C)(C)C.[Mn+2].
What is the InChIKey of bis(tert-butyl-[(Z)-4-tert-butyliminopent-2-en-2-yl]azanide);manganese(2+)?
The InChIKey is IYVWZTFDMLJIFQ-QCCMVMLGSA-N. The full InChI is InChI=1S/2C13H25N2.Mn/c2*1-10(14-12(3,4)5)9-11(2)15-13(6,7)8;/h2*9H,1-8H3;/q2*-1;+2/b2*10-9-,15-11-;.
What are the key properties of bis(tert-butyl-[(Z)-4-tert-butyliminopent-2-en-2-yl]azanide);manganese(2+)?
bis(tert-butyl-[(Z)-4-tert-butyliminopent-2-en-2-yl]azanide);manganese(2+) has a molecular weight of 473.65 g/mol, XLogP of 8.64, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for bis(tert-butyl-[(Z)-4-tert-butyliminopent-2-en-2-yl]azanide);manganese(2+) is sourced from PubChem (CID 162410087), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).