C10H26N4O6S2 — CID 123778865
3-[2-[(2-aminoethylamino)-(3-sulfopropyl)amino]ethylamino]propane-1-sulfonic acid (PubChem CID 123778865) has the molecular formula C10H26N4O6S2 and a molecular weight of 362.47 g/mol. Its IUPAC name is 3-[2-[(2-aminoethylamino)-(3-sulfopropyl)amino]ethylamino]propane-1-sulfonic acid.
| Compound Name | 3-[2-[(2-aminoethylamino)-(3-sulfopropyl)amino]ethylamino]propane-1-sulfonic acid |
|---|---|
| PubChem CID | 123778865 |
| Molecular Formula | C10H26N4O6S2 |
| Molecular Weight | 362.47 g/mol |
| Exact Mass | 362.13 |
| IUPAC Name | 3-[2-[(2-aminoethylamino)-(3-sulfopropyl)amino]ethylamino]propane-1-sulfonic acid |
| SMILES | NCCNN(CCCS(=O)(=O)O)CCNCCCS(=O)(=O)O |
| InChI | InChI=1S/C10H26N4O6S2/c11-3-5-13-14(7-2-10-22(18,19)20)8-6-12-4-1-9-21(15,16)17/h12-13H,1-11H2,(H,15,16,17)(H,18,19,20) |
| InChIKey | NWBMCWICFYLGJE-UHFFFAOYSA-N |
| XLogP | -2.10 |
| TPSA | 162.06 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.47 |
| LogP ≤ 5 | -2.10 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|