C11H31N7 — CID 90866572
N'-[2-[2-[2-(2-aminoethyl)-2-(3-aminopropyl)hydrazinyl]ethylamino]ethyl]ethane-1,2-diamine (PubChem CID 90866572) has the molecular formula C11H31N7 and a molecular weight of 261.42 g/mol. Its IUPAC name is N'-[2-[2-[2-(2-aminoethyl)-2-(3-aminopropyl)hydrazinyl]ethylamino]ethyl]ethane-1,2-diamine.
| Compound Name | N'-[2-[2-[2-(2-aminoethyl)-2-(3-aminopropyl)hydrazinyl]ethylamino]ethyl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 90866572 |
| Molecular Formula | C11H31N7 |
| Molecular Weight | 261.42 g/mol |
| Exact Mass | 261.26 |
| IUPAC Name | N'-[2-[2-[2-(2-aminoethyl)-2-(3-aminopropyl)hydrazinyl]ethylamino]ethyl]ethane-1,2-diamine |
| SMILES | NCCCN(CCN)NCCNCCNCCN |
| InChI | InChI=1S/C11H31N7/c12-2-1-10-18(11-4-14)17-9-8-16-7-6-15-5-3-13/h15-17H,1-14H2 |
| InChIKey | QVMSAGMSMZBSFJ-UHFFFAOYSA-N |
| XLogP | -2.76 |
| TPSA | 117.39 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.42 |
| LogP ≤ 5 | -2.76 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|