C10H21FN4 — CID 123778883
N-(2-fluoropropyl)-N-methyl-N'-(N,N,N'-trimethylcarbamimidoyl)ethanimidamide (PubChem CID 123778883) has the molecular formula C10H21FN4 and a molecular weight of 216.30 g/mol. Its IUPAC name is N-(2-fluoropropyl)-N-methyl-N'-(N,N,N'-trimethylcarbamimidoyl)ethanimidamide.
| Compound Name | N-(2-fluoropropyl)-N-methyl-N'-(N,N,N'-trimethylcarbamimidoyl)ethanimidamide |
|---|---|
| PubChem CID | 123778883 |
| Molecular Formula | C10H21FN4 |
| Molecular Weight | 216.30 g/mol |
| Exact Mass | 216.18 |
| IUPAC Name | N-(2-fluoropropyl)-N-methyl-N'-(N,N,N'-trimethylcarbamimidoyl)ethanimidamide |
| SMILES | C/N=C(/N=C(C)N(C)CC(C)F)N(C)C |
| InChI | InChI=1S/C10H21FN4/c1-8(11)7-15(6)9(2)13-10(12-3)14(4)5/h8H,7H2,1-6H3/b12-10-,13-9? |
| InChIKey | ZJKYHXMHAWOYJW-IYZNFVJJSA-N |
| XLogP | 1.24 |
| TPSA | 31.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.30 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|