C9H20N2 — CID 519058
N,N-diethyl-N'-propylethanimidamide (PubChem CID 519058) has the molecular formula C9H20N2 and a molecular weight of 156.27 g/mol. Its IUPAC name is N,N-diethyl-N'-propylethanimidamide.
| Compound Name | N,N-diethyl-N'-propylethanimidamide |
|---|---|
| PubChem CID | 519058 |
| Molecular Formula | C9H20N2 |
| Molecular Weight | 156.27 g/mol |
| Exact Mass | 156.16 |
| IUPAC Name | N,N-diethyl-N'-propylethanimidamide |
| SMILES | CCC/N=C(\C)N(CC)CC |
| InChI | InChI=1S/C9H20N2/c1-5-8-10-9(4)11(6-2)7-3/h5-8H2,1-4H3/b10-9+ |
| InChIKey | AGZSVOCXEYHQGE-MDZDMXLPSA-N |
| XLogP | 2.16 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.27 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|