C14H26N6 — CID 134915555
(3Z,7Z)-2-N,2-N,6-N,6-N-tetraethyl-4,8-dimethyl-1,3,5,7-tetrazocine-2,6-diamine (PubChem CID 134915555) has the molecular formula C14H26N6 and a molecular weight of 278.40 g/mol. Its IUPAC name is (3Z,7Z)-2-N,2-N,6-N,6-N-tetraethyl-4,8-dimethyl-1,3,5,7-tetrazocine-2,6-diamine.
| Compound Name | (3Z,7Z)-2-N,2-N,6-N,6-N-tetraethyl-4,8-dimethyl-1,3,5,7-tetrazocine-2,6-diamine |
|---|---|
| PubChem CID | 134915555 |
| Molecular Formula | C14H26N6 |
| Molecular Weight | 278.40 g/mol |
| Exact Mass | 278.22 |
| IUPAC Name | (3Z,7Z)-2-N,2-N,6-N,6-N-tetraethyl-4,8-dimethyl-1,3,5,7-tetrazocine-2,6-diamine |
| SMILES | CCN(CC)C1=N/C(C)=N\C(N(CC)CC)=N/C(C)=N\1 |
| InChI | InChI=1S/C14H26N6/c1-7-19(8-2)13-15-11(5)17-14(18-12(6)16-13)20(9-3)10-4/h7-10H2,1-6H3/b15-11-,15-13+,16-12-,16-13+,17-11-,17-14+,18-12-,18-14+ |
| InChIKey | HWPOKTKREQJBFD-HJKWIMICSA-N |
| XLogP | 2.23 |
| TPSA | 55.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.40 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |