C21H25NO4 — CID 123779612
(9E,11E)-12-[[(2E,5E)-6-carboxy-4-methylhexa-2,5-dienylidene]amino]-4-methyldodeca-2,4,7,9,11-pentaenoic acid (PubChem CID 123779612) has the molecular formula C21H25NO4 and a molecular weight of 355.43 g/mol. Its IUPAC name is (9E,11E)-12-[[(2E,5E)-6-carboxy-4-methylhexa-2,5-dienylidene]amino]-4-methyldodeca-2,4,7,9,11-pentaenoic acid.
| Compound Name | (9E,11E)-12-[[(2E,5E)-6-carboxy-4-methylhexa-2,5-dienylidene]amino]-4-methyldodeca-2,4,7,9,11-pentaenoic acid |
|---|---|
| PubChem CID | 123779612 |
| Molecular Formula | C21H25NO4 |
| Molecular Weight | 355.43 g/mol |
| Exact Mass | 355.18 |
| IUPAC Name | (9E,11E)-12-[[(2E,5E)-6-carboxy-4-methylhexa-2,5-dienylidene]amino]-4-methyldodeca-2,4,7,9,11-pentaenoic acid |
| SMILES | CC(C=CC(=O)O)=CCC=C/C=C/C=C/N=C/C=C/C(C)/C=C/C(=O)O |
| InChI | InChI=1S/C21H25NO4/c1-18(12-14-20(23)24)10-7-5-3-4-6-8-16-22-17-9-11-19(2)13-15-21(25)26/h3-6,8-17,19H,7H2,1-2H3,(H,23,24)(H,25,26)/b5-3?,6-4+,11-9+,14-12?,15-13+,16-8+,18-10?,22-17+ |
| InChIKey | LLZMIYOSYYVXFJ-APRPHVLHSA-N |
| XLogP | 4.49 |
| TPSA | 86.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.43 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|