8-methylimino-5-prop-1-enylocta-2,4,6-trienoic acid

C12H15NO2 — CID 90916109

IUPAC8-methylimino-5-prop-1-enylocta-2,4,6-trienoic acid
SMILESCC=CC(C=C/C=N/C)=CC=CC(=O)O
InChIInChI=1S/C12H15NO2/c1-3-6-11(8-5-10-13-2)7-4-9-12(14)15/h3-10H,1-2H3,(H,14,15)/b6-3?,8-5?,9-4?,11-7?,13-10+
InChIKeyTYLZIHHSPMORDP-CAUDJCAVSA-N
MW205.26 g/mol
LogP2.39
Rot. Bonds5

About 8-methylimino-5-prop-1-enylocta-2,4,6-trienoic acid

8-methylimino-5-prop-1-enylocta-2,4,6-trienoic acid (PubChem CID 90916109) has the molecular formula C12H15NO2 and a molecular weight of 205.26 g/mol. Its IUPAC name is 8-methylimino-5-prop-1-enylocta-2,4,6-trienoic acid.

Molecular Properties

Compound Name8-methylimino-5-prop-1-enylocta-2,4,6-trienoic acid
PubChem CID90916109
Molecular FormulaC12H15NO2
Molecular Weight205.26 g/mol
Exact Mass205.11
IUPAC Name8-methylimino-5-prop-1-enylocta-2,4,6-trienoic acid
SMILESCC=CC(C=C/C=N/C)=CC=CC(=O)O
InChIInChI=1S/C12H15NO2/c1-3-6-11(8-5-10-13-2)7-4-9-12(14)15/h3-10H,1-2H3,(H,14,15)/b6-3?,8-5?,9-4?,11-7?,13-10+
InChIKeyTYLZIHHSPMORDP-CAUDJCAVSA-N
XLogP2.39
TPSA49.66 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds5
Heavy Atoms15
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500205.26
LogP ≤ 52.39
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}

Analyze 8-methylimino-5-prop-1-enylocta-2,4,6-trienoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 8-methylimino-5-prop-1-enylocta-2,4,6-trienoic acid?
The IUPAC name of 8-methylimino-5-prop-1-enylocta-2,4,6-trienoic acid (CID 90916109) is 8-methylimino-5-prop-1-enylocta-2,4,6-trienoic acid.
What is the SMILES notation for 8-methylimino-5-prop-1-enylocta-2,4,6-trienoic acid?
The canonical SMILES for 8-methylimino-5-prop-1-enylocta-2,4,6-trienoic acid is CC=CC(C=C/C=N/C)=CC=CC(=O)O.
What is the InChIKey of 8-methylimino-5-prop-1-enylocta-2,4,6-trienoic acid?
The InChIKey is TYLZIHHSPMORDP-CAUDJCAVSA-N. The full InChI is InChI=1S/C12H15NO2/c1-3-6-11(8-5-10-13-2)7-4-9-12(14)15/h3-10H,1-2H3,(H,14,15)/b6-3?,8-5?,9-4?,11-7?,13-10+.
What are the key properties of 8-methylimino-5-prop-1-enylocta-2,4,6-trienoic acid?
8-methylimino-5-prop-1-enylocta-2,4,6-trienoic acid has a molecular weight of 205.26 g/mol, XLogP of 2.39, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 8-methylimino-5-prop-1-enylocta-2,4,6-trienoic acid is sourced from PubChem (CID 90916109), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).