C10H13F2NO2 — CID 142397654
(2E,4Z)-4-(difluoromethyl)-2-(methyliminomethyl)hepta-2,4-dienoic acid (PubChem CID 142397654) has the molecular formula C10H13F2NO2 and a molecular weight of 217.22 g/mol. Its IUPAC name is (2E,4Z)-4-(difluoromethyl)-2-(methyliminomethyl)hepta-2,4-dienoic acid.
| Compound Name | (2E,4Z)-4-(difluoromethyl)-2-(methyliminomethyl)hepta-2,4-dienoic acid |
|---|---|
| PubChem CID | 142397654 |
| Molecular Formula | C10H13F2NO2 |
| Molecular Weight | 217.22 g/mol |
| Exact Mass | 217.09 |
| IUPAC Name | (2E,4Z)-4-(difluoromethyl)-2-(methyliminomethyl)hepta-2,4-dienoic acid |
| SMILES | CC/C=C(/C=C(\C=N\C)C(=O)O)C(F)F |
| InChI | InChI=1S/C10H13F2NO2/c1-3-4-7(9(11)12)5-8(6-13-2)10(14)15/h4-6,9H,3H2,1-2H3,(H,14,15)/b7-4-,8-5+,13-6+ |
| InChIKey | LFNSYWDBELGQPB-NMPBURMZSA-N |
| XLogP | 2.30 |
| TPSA | 49.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.22 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|