C9H11F3NO3+ — CID 87563297
[(2E,4E)-4-carboxy-6,6,6-trifluoro-5-hydroxyhexa-2,4-dienylidene]-dimethylazanium (PubChem CID 87563297) has the molecular formula C9H11F3NO3+ and a molecular weight of 238.18 g/mol. Its IUPAC name is [(2E,4E)-4-carboxy-6,6,6-trifluoro-5-hydroxyhexa-2,4-dienylidene]-dimethylazanium.
| Compound Name | [(2E,4E)-4-carboxy-6,6,6-trifluoro-5-hydroxyhexa-2,4-dienylidene]-dimethylazanium |
|---|---|
| PubChem CID | 87563297 |
| Molecular Formula | C9H11F3NO3+ |
| Molecular Weight | 238.18 g/mol |
| Exact Mass | 238.07 |
| IUPAC Name | [(2E,4E)-4-carboxy-6,6,6-trifluoro-5-hydroxyhexa-2,4-dienylidene]-dimethylazanium |
| SMILES | C[N+](C)=C/C=C/C(C(=O)O)=C(\O)C(F)(F)F |
| InChI | InChI=1S/C9H10F3NO3/c1-13(2)5-3-4-6(8(15)16)7(14)9(10,11)12/h3-5H,1-2H3,(H,15,16)/p+1 |
| InChIKey | YAZJYYXKDRKJTF-UHFFFAOYSA-O |
| XLogP | 1.34 |
| TPSA | 60.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.18 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|