C10H12F3NO2 — CID 142397569
(E,2E)-2-[1-(ethylideneamino)-2,2,2-trifluoroethylidene]hex-3-enoic acid (PubChem CID 142397569) has the molecular formula C10H12F3NO2 and a molecular weight of 235.20 g/mol. Its IUPAC name is (E,2E)-2-[1-(ethylideneamino)-2,2,2-trifluoroethylidene]hex-3-enoic acid.
| Compound Name | (E,2E)-2-[1-(ethylideneamino)-2,2,2-trifluoroethylidene]hex-3-enoic acid |
|---|---|
| PubChem CID | 142397569 |
| Molecular Formula | C10H12F3NO2 |
| Molecular Weight | 235.20 g/mol |
| Exact Mass | 235.08 |
| IUPAC Name | (E,2E)-2-[1-(ethylideneamino)-2,2,2-trifluoroethylidene]hex-3-enoic acid |
| SMILES | C/C=N/C(=C(\C=C\CC)C(=O)O)C(F)(F)F |
| InChI | InChI=1S/C10H12F3NO2/c1-3-5-6-7(9(15)16)8(14-4-2)10(11,12)13/h4-6H,3H2,1-2H3,(H,15,16)/b6-5+,8-7+,14-4+ |
| InChIKey | GRPUELQFFROXPA-XFPWNWJVSA-N |
| XLogP | 2.94 |
| TPSA | 49.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.20 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|