C26H29N5O2 — CID 123779644
3-[1-[3-(4-methylpiperazin-1-yl)propyl]indol-3-yl]-4-phenyliminopyrrolidine-2,5-dione (PubChem CID 123779644) has the molecular formula C26H29N5O2 and a molecular weight of 443.55 g/mol. Its IUPAC name is 3-[1-[3-(4-methylpiperazin-1-yl)propyl]indol-3-yl]-4-phenyliminopyrrolidine-2,5-dione.
| Compound Name | 3-[1-[3-(4-methylpiperazin-1-yl)propyl]indol-3-yl]-4-phenyliminopyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 123779644 |
| Molecular Formula | C26H29N5O2 |
| Molecular Weight | 443.55 g/mol |
| Exact Mass | 443.23 |
| IUPAC Name | 3-[1-[3-(4-methylpiperazin-1-yl)propyl]indol-3-yl]-4-phenyliminopyrrolidine-2,5-dione |
| SMILES | CN1CCN(CCCn2cc(C3C(=O)NC(=O)/C3=N\c3ccccc3)c3ccccc32)CC1 |
| InChI | InChI=1S/C26H29N5O2/c1-29-14-16-30(17-15-29)12-7-13-31-18-21(20-10-5-6-11-22(20)31)23-24(26(33)28-25(23)32)27-19-8-3-2-4-9-19/h2-6,8-11,18,23H,7,12-17H2,1H3,(H,28,32,33)/b27-24- |
| InChIKey | HLWXDFKKLWANMR-PNHLSOANSA-N |
| XLogP | 2.79 |
| TPSA | 69.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.55 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|