C25H22ClN5O2 — CID 123903006
3-(3-chlorophenyl)imino-4-[1-(4-imidazol-1-ylbutyl)indol-3-yl]pyrrolidine-2,5-dione (PubChem CID 123903006) has the molecular formula C25H22ClN5O2 and a molecular weight of 459.94 g/mol. Its IUPAC name is 3-(3-chlorophenyl)imino-4-[1-(4-imidazol-1-ylbutyl)indol-3-yl]pyrrolidine-2,5-dione.
| Compound Name | 3-(3-chlorophenyl)imino-4-[1-(4-imidazol-1-ylbutyl)indol-3-yl]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 123903006 |
| Molecular Formula | C25H22ClN5O2 |
| Molecular Weight | 459.94 g/mol |
| Exact Mass | 459.15 |
| IUPAC Name | 3-(3-chlorophenyl)imino-4-[1-(4-imidazol-1-ylbutyl)indol-3-yl]pyrrolidine-2,5-dione |
| SMILES | O=C1NC(=O)C(c2cn(CCCCn3ccnc3)c3ccccc23)/C1=N/c1cccc(Cl)c1 |
| InChI | InChI=1S/C25H22ClN5O2/c26-17-6-5-7-18(14-17)28-23-22(24(32)29-25(23)33)20-15-31(21-9-2-1-8-19(20)21)12-4-3-11-30-13-10-27-16-30/h1-2,5-10,13-16,22H,3-4,11-12H2,(H,29,32,33)/b28-23- |
| InChIKey | CGVBRIPUEVGLRG-NFFVHWSESA-N |
| XLogP | 4.48 |
| TPSA | 81.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.94 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|