C19H19ClN4O — CID 169383026
N-[[5-chloro-2-(3-imidazol-1-ylpropoxy)phenyl]methylideneamino]aniline (PubChem CID 169383026) has the molecular formula C19H19ClN4O and a molecular weight of 354.84 g/mol. Its IUPAC name is N-[[5-chloro-2-(3-imidazol-1-ylpropoxy)phenyl]methylideneamino]aniline.
| Compound Name | N-[[5-chloro-2-(3-imidazol-1-ylpropoxy)phenyl]methylideneamino]aniline |
|---|---|
| PubChem CID | 169383026 |
| Molecular Formula | C19H19ClN4O |
| Molecular Weight | 354.84 g/mol |
| Exact Mass | 354.12 |
| IUPAC Name | N-[[5-chloro-2-(3-imidazol-1-ylpropoxy)phenyl]methylideneamino]aniline |
| SMILES | Clc1ccc(OCCCn2ccnc2)c(C=NNc2ccccc2)c1 |
| InChI | InChI=1S/C19H19ClN4O/c20-17-7-8-19(25-12-4-10-24-11-9-21-15-24)16(13-17)14-22-23-18-5-2-1-3-6-18/h1-3,5-9,11,13-15,23H,4,10,12H2 |
| InChIKey | AUBRVGBKILVPKH-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 51.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.84 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|