C24H20ClN5O2 — CID 70204959
3-(4-chloroanilino)-4-[1-(3-imidazol-1-ylpropyl)indol-3-yl]pyrrole-2,5-dione (PubChem CID 70204959) has the molecular formula C24H20ClN5O2 and a molecular weight of 445.91 g/mol. Its IUPAC name is 3-(4-chloroanilino)-4-[1-(3-imidazol-1-ylpropyl)indol-3-yl]pyrrole-2,5-dione.
| Compound Name | 3-(4-chloroanilino)-4-[1-(3-imidazol-1-ylpropyl)indol-3-yl]pyrrole-2,5-dione |
|---|---|
| PubChem CID | 70204959 |
| Molecular Formula | C24H20ClN5O2 |
| Molecular Weight | 445.91 g/mol |
| Exact Mass | 445.13 |
| IUPAC Name | 3-(4-chloroanilino)-4-[1-(3-imidazol-1-ylpropyl)indol-3-yl]pyrrole-2,5-dione |
| SMILES | O=C1NC(=O)C(c2cn(CCCn3ccnc3)c3ccccc23)=C1Nc1ccc(Cl)cc1 |
| InChI | InChI=1S/C24H20ClN5O2/c25-16-6-8-17(9-7-16)27-22-21(23(31)28-24(22)32)19-14-30(20-5-2-1-4-18(19)20)12-3-11-29-13-10-26-15-29/h1-2,4-10,13-15H,3,11-12H2,(H2,27,28,31,32) |
| InChIKey | WEMIEYZIEISWKU-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 80.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.91 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|