C25H20F3N5O2 — CID 70205687
3-[1-(3-imidazol-1-ylpropyl)indol-3-yl]-4-[4-(trifluoromethyl)anilino]pyrrole-2,5-dione (PubChem CID 70205687) has the molecular formula C25H20F3N5O2 and a molecular weight of 479.46 g/mol. Its IUPAC name is 3-[1-(3-imidazol-1-ylpropyl)indol-3-yl]-4-[4-(trifluoromethyl)anilino]pyrrole-2,5-dione.
| Compound Name | 3-[1-(3-imidazol-1-ylpropyl)indol-3-yl]-4-[4-(trifluoromethyl)anilino]pyrrole-2,5-dione |
|---|---|
| PubChem CID | 70205687 |
| Molecular Formula | C25H20F3N5O2 |
| Molecular Weight | 479.46 g/mol |
| Exact Mass | 479.16 |
| IUPAC Name | 3-[1-(3-imidazol-1-ylpropyl)indol-3-yl]-4-[4-(trifluoromethyl)anilino]pyrrole-2,5-dione |
| SMILES | O=C1NC(=O)C(c2cn(CCCn3ccnc3)c3ccccc23)=C1Nc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C25H20F3N5O2/c26-25(27,28)16-6-8-17(9-7-16)30-22-21(23(34)31-24(22)35)19-14-33(20-5-2-1-4-18(19)20)12-3-11-32-13-10-29-15-32/h1-2,4-10,13-15H,3,11-12H2,(H2,30,31,34,35) |
| InChIKey | NYMNQGPREGYGMA-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 80.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.46 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|