C10H14N2 — CID 123780876
N-(3-but-2-enyl-2,5-dihydropyridin-2-yl)methanimine (PubChem CID 123780876) has the molecular formula C10H14N2 and a molecular weight of 162.24 g/mol. Its IUPAC name is N-(3-but-2-enyl-2,5-dihydropyridin-2-yl)methanimine.
| Compound Name | N-(3-but-2-enyl-2,5-dihydropyridin-2-yl)methanimine |
|---|---|
| PubChem CID | 123780876 |
| Molecular Formula | C10H14N2 |
| Molecular Weight | 162.24 g/mol |
| Exact Mass | 162.12 |
| IUPAC Name | N-(3-but-2-enyl-2,5-dihydropyridin-2-yl)methanimine |
| SMILES | C=NC1N=CCC=C1CC=CC |
| InChI | InChI=1S/C10H14N2/c1-3-4-6-9-7-5-8-12-10(9)11-2/h3-4,7-8,10H,2,5-6H2,1H3 |
| InChIKey | JZNSMFFCSVPNRA-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.24 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|