C21H19ClF3NO3 — CID 123781541
6-[3-(2-chlorophenyl)-1,1,1-trifluoro-2-hydroxybutan-2-yl]-4-prop-2-enyl-1,4-benzoxazin-3-one (PubChem CID 123781541) has the molecular formula C21H19ClF3NO3 and a molecular weight of 425.83 g/mol. Its IUPAC name is 6-[3-(2-chlorophenyl)-1,1,1-trifluoro-2-hydroxybutan-2-yl]-4-prop-2-enyl-1,4-benzoxazin-3-one.
| Compound Name | 6-[3-(2-chlorophenyl)-1,1,1-trifluoro-2-hydroxybutan-2-yl]-4-prop-2-enyl-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 123781541 |
| Molecular Formula | C21H19ClF3NO3 |
| Molecular Weight | 425.83 g/mol |
| Exact Mass | 425.10 |
| IUPAC Name | 6-[3-(2-chlorophenyl)-1,1,1-trifluoro-2-hydroxybutan-2-yl]-4-prop-2-enyl-1,4-benzoxazin-3-one |
| SMILES | C=CCN1C(=O)COc2ccc(C(O)(C(C)c3ccccc3Cl)C(F)(F)F)cc21 |
| InChI | InChI=1S/C21H19ClF3NO3/c1-3-10-26-17-11-14(8-9-18(17)29-12-19(26)27)20(28,21(23,24)25)13(2)15-6-4-5-7-16(15)22/h3-9,11,13,28H,1,10,12H2,2H3 |
| InChIKey | YJELUELAYUNHFB-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.83 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|