About ethyl (5R)-5-(4-fluorophenyl)-4-phenyl-2,5-dihydro-1,2-oxazole-3-carboxylate
ethyl (5R)-5-(4-fluorophenyl)-4-phenyl-2,5-dihydro-1,2-oxazole-3-carboxylate (PubChem CID 123781941) has the molecular formula C18H16FNO3
and a molecular weight of 313.33 g/mol. Its IUPAC name is ethyl (5R)-5-(4-fluorophenyl)-4-phenyl-2,5-dihydro-1,2-oxazole-3-carboxylate.
Molecular Properties
| Compound Name | ethyl (5R)-5-(4-fluorophenyl)-4-phenyl-2,5-dihydro-1,2-oxazole-3-carboxylate |
| PubChem CID | 123781941 |
| Molecular Formula | C18H16FNO3 |
| Molecular Weight | 313.33 g/mol |
| Exact Mass | 313.11 |
| IUPAC Name | ethyl (5R)-5-(4-fluorophenyl)-4-phenyl-2,5-dihydro-1,2-oxazole-3-carboxylate |
| SMILES | CCOC(=O)C1=C(c2ccccc2)[C@@H](c2ccc(F)cc2)ON1 |
| InChI | InChI=1S/C18H16FNO3/c1-2-22-18(21)16-15(12-6-4-3-5-7-12)17(23-20-16)13-8-10-14(19)11-9-13/h3-11,17,20H,2H2,1H3/t17-/m1/s1 |
| InChIKey | AIHRNCIBICASIH-QGZVFWFLSA-N |
| XLogP | 3.38 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 313.33 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze ethyl (5R)-5-(4-fluorophenyl)-4-phenyl-2,5-dihydro-1,2-oxazole-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl (5R)-5-(4-fluorophenyl)-4-phenyl-2,5-dihydro-1,2-oxazole-3-carboxylate?
The IUPAC name of ethyl (5R)-5-(4-fluorophenyl)-4-phenyl-2,5-dihydro-1,2-oxazole-3-carboxylate (CID 123781941) is ethyl (5R)-5-(4-fluorophenyl)-4-phenyl-2,5-dihydro-1,2-oxazole-3-carboxylate.
What is the SMILES notation for ethyl (5R)-5-(4-fluorophenyl)-4-phenyl-2,5-dihydro-1,2-oxazole-3-carboxylate?
The canonical SMILES for ethyl (5R)-5-(4-fluorophenyl)-4-phenyl-2,5-dihydro-1,2-oxazole-3-carboxylate is CCOC(=O)C1=C(c2ccccc2)[C@@H](c2ccc(F)cc2)ON1.
What is the InChIKey of ethyl (5R)-5-(4-fluorophenyl)-4-phenyl-2,5-dihydro-1,2-oxazole-3-carboxylate?
The InChIKey is AIHRNCIBICASIH-QGZVFWFLSA-N. The full InChI is InChI=1S/C18H16FNO3/c1-2-22-18(21)16-15(12-6-4-3-5-7-12)17(23-20-16)13-8-10-14(19)11-9-13/h3-11,17,20H,2H2,1H3/t17-/m1/s1.
What are the key properties of ethyl (5R)-5-(4-fluorophenyl)-4-phenyl-2,5-dihydro-1,2-oxazole-3-carboxylate?
ethyl (5R)-5-(4-fluorophenyl)-4-phenyl-2,5-dihydro-1,2-oxazole-3-carboxylate has a molecular weight of 313.33 g/mol, XLogP of 3.38, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl (5R)-5-(4-fluorophenyl)-4-phenyl-2,5-dihydro-1,2-oxazole-3-carboxylate is sourced from PubChem (CID 123781941), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).